About [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate
[5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate (PubChem CID 67938071) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate |
| PubChem CID | 67938071 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate |
| SMILES | CCOCc1cccc2[nH]c3cnc(OC(=O)OCC)c(C)c3c12 |
| InChI | InChI=1S/C18H20N2O4/c1-4-22-10-12-7-6-8-13-16(12)15-11(3)17(19-9-14(15)20-13)24-18(21)23-5-2/h6-9,20H,4-5,10H2,1-3H3 |
| InChIKey | VLLMEWNLJXWXFC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The IUPAC name of [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate (CID 67938071) is [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate.
What is the SMILES notation for [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The canonical SMILES for [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate is CCOCc1cccc2[nH]c3cnc(OC(=O)OCC)c(C)c3c12.
What is the InChIKey of [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
The InChIKey is VLLMEWNLJXWXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4/c1-4-22-10-12-7-6-8-13-16(12)15-11(3)17(19-9-14(15)20-13)24-18(21)23-5-2/h6-9,20H,4-5,10H2,1-3H3.
What are the key properties of [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate?
[5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate has a molecular weight of 328.37 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(ethoxymethyl)-4-methyl-9H-pyrido[3,4-b]indol-3-yl] ethyl carbonate is sourced from PubChem (CID 67938071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).