About 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine
4,11-dihydro-[1]benzoxepino[3,4-b]pyridine (PubChem CID 67938472) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine |
| PubChem CID | 67938472 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine |
| SMILES | C1=CNC2=COc3ccccc3CC2=C1 |
| InChI | InChI=1S/C13H11NO/c1-2-6-13-11(4-1)8-10-5-3-7-14-12(10)9-15-13/h1-7,9,14H,8H2 |
| InChIKey | MRJBVENEDCDRJA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine?
The IUPAC name of 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine (CID 67938472) is 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine.
What is the SMILES notation for 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine?
The canonical SMILES for 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine is C1=CNC2=COc3ccccc3CC2=C1.
What is the InChIKey of 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine?
The InChIKey is MRJBVENEDCDRJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-2-6-13-11(4-1)8-10-5-3-7-14-12(10)9-15-13/h1-7,9,14H,8H2.
What are the key properties of 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine?
4,11-dihydro-[1]benzoxepino[3,4-b]pyridine has a molecular weight of 197.24 g/mol, XLogP of 2.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,11-dihydro-[1]benzoxepino[3,4-b]pyridine is sourced from PubChem (CID 67938472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).