C25H34O17 — CID 67938751
[(2R,3R,4S,5R)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S,6R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate (PubChem CID 67938751) has the molecular formula C25H34O17 and a molecular weight of 606.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S,6R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S,6R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67938751 |
| Molecular Formula | C25H34O17 |
| Molecular Weight | 606.53 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-[[(2R,3R,4S,5S,6R)-3,4,5,6-tetraacetyl-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC[C@H]2O[C@@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@]2(O)C(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H34O17/c1-10(26)22(33)18(42-25(36,13(4)29)24(35,12(3)28)23(22,34)11(2)27)9-38-21-20(40-16(7)32)19(39-15(6)31)17(41-21)8-37-14(5)30/h17-21,33-36H,8-9H2,1-7H3/t17-,18-,19-,20+,21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | IGYNJHSQOQPWJL-UWSKNNCESA-N |
| XLogP | -3.21 |
| TPSA | 255.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.53 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|