C25H37NO9 — CID 67938789
benzyl N-[3-[(3aR,4R,6R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]propyl]carbamate (PubChem CID 67938789) has the molecular formula C25H37NO9 and a molecular weight of 495.57 g/mol. Its IUPAC name is benzyl N-[3-[(3aR,4R,6R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]propyl]carbamate.
| Compound Name | benzyl N-[3-[(3aR,4R,6R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]propyl]carbamate |
|---|---|
| PubChem CID | 67938789 |
| Molecular Formula | C25H37NO9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | benzyl N-[3-[(3aR,4R,6R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-hydroxy-6-(hydroxymethyl)-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl]propyl]carbamate |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)O[C@@](O)(CO)C(CCCNC(=O)OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C25H37NO9/c1-23(2)31-14-18(32-23)20-21-19(33-24(3,4)34-21)17(25(29,15-27)35-20)11-8-12-26-22(28)30-13-16-9-6-5-7-10-16/h5-7,9-10,17-21,27,29H,8,11-15H2,1-4H3,(H,26,28)/t17?,18-,19-,20-,21-,25+/m1/s1 |
| InChIKey | MAOFYHPYFKNHAE-DDBUWETJSA-N |
| XLogP | 2.06 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|