C31H41N9OS — CID 67938840
2,5-bis[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[3,2-c]pyridin-4-one (PubChem CID 67938840) has the molecular formula C31H41N9OS and a molecular weight of 587.80 g/mol. Its IUPAC name is 2,5-bis[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[3,2-c]pyridin-4-one.
| Compound Name | 2,5-bis[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 67938840 |
| Molecular Formula | C31H41N9OS |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.32 |
| IUPAC Name | 2,5-bis[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2cc(CCCCN3CCN(c4ncccn4)CC3)sc2ccn1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C31H41N9OS/c41-29-27-25-26(7-1-2-13-36-17-21-39(22-18-36)30-32-9-5-10-33-30)42-28(27)8-16-38(29)15-4-3-14-37-19-23-40(24-20-37)31-34-11-6-12-35-31/h5-6,8-12,16,25H,1-4,7,13-15,17-24H2 |
| InChIKey | XPCILAAAXMTJFH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|