About 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one
4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one (PubChem CID 67939026) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one.
Molecular Properties
| Compound Name | 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one |
| PubChem CID | 67939026 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one |
| SMILES | C=CCc1nc(N)c2c(n1)NC(=O)CO2 |
| InChI | InChI=1S/C9H10N4O2/c1-2-3-5-11-8(10)7-9(12-5)13-6(14)4-15-7/h2H,1,3-4H2,(H3,10,11,12,13,14) |
| InChIKey | ONMGEVXOJMPHFM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
The IUPAC name of 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one (CID 67939026) is 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one.
What is the SMILES notation for 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
The canonical SMILES for 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one is C=CCc1nc(N)c2c(n1)NC(=O)CO2.
What is the InChIKey of 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
The InChIKey is ONMGEVXOJMPHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-2-3-5-11-8(10)7-9(12-5)13-6(14)4-15-7/h2H,1,3-4H2,(H3,10,11,12,13,14).
What are the key properties of 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one has a molecular weight of 206.20 g/mol, XLogP of 0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-prop-2-enyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one is sourced from PubChem (CID 67939026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).