About [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate
[4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate (PubChem CID 67939181) has the molecular formula C22H28N2O5
and a molecular weight of 400.48 g/mol. Its IUPAC name is [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate.
Molecular Properties
| Compound Name | [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate |
| PubChem CID | 67939181 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate |
| SMILES | CCCOC(C)c1cccc2[nH]c3cnc(OC(=O)OC(C)C)c(COC)c3c12 |
| InChI | InChI=1S/C22H28N2O5/c1-6-10-27-14(4)15-8-7-9-17-19(15)20-16(12-26-5)21(23-11-18(20)24-17)29-22(25)28-13(2)3/h7-9,11,13-14,24H,6,10,12H2,1-5H3 |
| InChIKey | GEBLZHAPZWYNAK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The IUPAC name of [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate (CID 67939181) is [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate.
What is the SMILES notation for [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The canonical SMILES for [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate is CCCOC(C)c1cccc2[nH]c3cnc(OC(=O)OC(C)C)c(COC)c3c12.
What is the InChIKey of [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The InChIKey is GEBLZHAPZWYNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O5/c1-6-10-27-14(4)15-8-7-9-17-19(15)20-16(12-26-5)21(23-11-18(20)24-17)29-22(25)28-13(2)3/h7-9,11,13-14,24H,6,10,12H2,1-5H3.
What are the key properties of [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
[4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate has a molecular weight of 400.48 g/mol, XLogP of 5.27, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methoxymethyl)-5-(1-propoxyethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate is sourced from PubChem (CID 67939181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).