C22H33F5S — CID 67939353
1-butyl-4-(4-phenylsulfanylcyclohexyl)benzene;pentahydrofluoride (PubChem CID 67939353) has the molecular formula C22H33F5S and a molecular weight of 424.56 g/mol. Its IUPAC name is 1-butyl-4-(4-phenylsulfanylcyclohexyl)benzene;pentahydrofluoride.
| Compound Name | 1-butyl-4-(4-phenylsulfanylcyclohexyl)benzene;pentahydrofluoride |
|---|---|
| PubChem CID | 67939353 |
| Molecular Formula | C22H33F5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-butyl-4-(4-phenylsulfanylcyclohexyl)benzene;pentahydrofluoride |
| SMILES | CCCCc1ccc(C2CCC(Sc3ccccc3)CC2)cc1.F.F.F.F.F |
| InChI | InChI=1S/C22H28S.5FH/c1-2-3-7-18-10-12-19(13-11-18)20-14-16-22(17-15-20)23-21-8-5-4-6-9-21;;;;;/h4-6,8-13,20,22H,2-3,7,14-17H2,1H3;5*1H |
| InChIKey | NQRRAMAFKCKOLV-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |