C11H21N7 — CID 67940125
6-[2-(2-ethyl-4-methylimidazol-1-yl)ethyl]-2,4-dihydro-1,3,5-triazine-1,3-diamine (PubChem CID 67940125) has the molecular formula C11H21N7 and a molecular weight of 251.34 g/mol. Its IUPAC name is 6-[2-(2-ethyl-4-methylimidazol-1-yl)ethyl]-2,4-dihydro-1,3,5-triazine-1,3-diamine.
| Compound Name | 6-[2-(2-ethyl-4-methylimidazol-1-yl)ethyl]-2,4-dihydro-1,3,5-triazine-1,3-diamine |
|---|---|
| PubChem CID | 67940125 |
| Molecular Formula | C11H21N7 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 6-[2-(2-ethyl-4-methylimidazol-1-yl)ethyl]-2,4-dihydro-1,3,5-triazine-1,3-diamine |
| SMILES | CCc1nc(C)cn1CCC1=NCN(N)CN1N |
| InChI | InChI=1S/C11H21N7/c1-3-10-15-9(2)6-16(10)5-4-11-14-7-17(12)8-18(11)13/h6H,3-5,7-8,12-13H2,1-2H3 |
| InChIKey | CILJJUIOPDXEFO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|