About 2-methylazetidine;4-methylbenzamide
2-methylazetidine;4-methylbenzamide (PubChem CID 67940263) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-methylazetidine;4-methylbenzamide.
Molecular Properties
| Compound Name | 2-methylazetidine;4-methylbenzamide |
| PubChem CID | 67940263 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-methylazetidine;4-methylbenzamide |
| SMILES | CC1CCN1.Cc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C8H9NO.C4H9N/c1-6-2-4-7(5-3-6)8(9)10;1-4-2-3-5-4/h2-5H,1H3,(H2,9,10);4-5H,2-3H2,1H3 |
| InChIKey | UDCGDEGLHDZBJC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylazetidine;4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylazetidine;4-methylbenzamide?
The IUPAC name of 2-methylazetidine;4-methylbenzamide (CID 67940263) is 2-methylazetidine;4-methylbenzamide.
What is the SMILES notation for 2-methylazetidine;4-methylbenzamide?
The canonical SMILES for 2-methylazetidine;4-methylbenzamide is CC1CCN1.Cc1ccc(C(N)=O)cc1.
What is the InChIKey of 2-methylazetidine;4-methylbenzamide?
The InChIKey is UDCGDEGLHDZBJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C4H9N/c1-6-2-4-7(5-3-6)8(9)10;1-4-2-3-5-4/h2-5H,1H3,(H2,9,10);4-5H,2-3H2,1H3.
What are the key properties of 2-methylazetidine;4-methylbenzamide?
2-methylazetidine;4-methylbenzamide has a molecular weight of 206.29 g/mol, XLogP of 1.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylazetidine;4-methylbenzamide is sourced from PubChem (CID 67940263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).