C20H21F2N3O3 — CID 67940770
1-tert-butyl-6,8-difluoro-4-oxo-7-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)quinoline-3-carboxylic acid (PubChem CID 67940770) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 1-tert-butyl-6,8-difluoro-4-oxo-7-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)quinoline-3-carboxylic acid.
| Compound Name | 1-tert-butyl-6,8-difluoro-4-oxo-7-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67940770 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-tert-butyl-6,8-difluoro-4-oxo-7-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)quinoline-3-carboxylic acid |
| SMILES | CC(C)(C)n1cc(C(=O)O)c(=O)c2cc(F)c(N3CC4=C(CNC4)C3)c(F)c21 |
| InChI | InChI=1S/C20H21F2N3O3/c1-20(2,3)25-9-13(19(27)28)18(26)12-4-14(21)17(15(22)16(12)25)24-7-10-5-23-6-11(10)8-24/h4,9,23H,5-8H2,1-3H3,(H,27,28) |
| InChIKey | IXOCNENZRVGZSZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|