About 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene
1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene (PubChem CID 67941557) has the molecular formula C15H23Cl
and a molecular weight of 238.80 g/mol. Its IUPAC name is 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene |
| PubChem CID | 67941557 |
| Molecular Formula | C15H23Cl |
| Molecular Weight | 238.80 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene |
| SMILES | CC(C)(C)C1=CC(=CCl)C=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H23Cl/c1-14(2,3)12-7-11(10-16)8-13(9-12)15(4,5)6/h7-8,10H,9H2,1-6H3 |
| InChIKey | VEIUPLAJJKRDCI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene?
The IUPAC name of 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene (CID 67941557) is 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene.
What is the SMILES notation for 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene?
The canonical SMILES for 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene is CC(C)(C)C1=CC(=CCl)C=C(C(C)(C)C)C1.
What is the InChIKey of 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene?
The InChIKey is VEIUPLAJJKRDCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23Cl/c1-14(2,3)12-7-11(10-16)8-13(9-12)15(4,5)6/h7-8,10H,9H2,1-6H3.
What are the key properties of 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene?
1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene has a molecular weight of 238.80 g/mol, XLogP of 5.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-ditert-butyl-3-(chloromethylidene)cyclohexa-1,4-diene is sourced from PubChem (CID 67941557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).