C15H28O6Si — CID 67941935
(3aR,6R,6aS)-3a-[tert-butyl(dimethyl)silyl]-6-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one (PubChem CID 67941935) has the molecular formula C15H28O6Si and a molecular weight of 332.47 g/mol. Its IUPAC name is (3aR,6R,6aS)-3a-[tert-butyl(dimethyl)silyl]-6-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6R,6aS)-3a-[tert-butyl(dimethyl)silyl]-6-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 67941935 |
| Molecular Formula | C15H28O6Si |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (3aR,6R,6aS)-3a-[tert-butyl(dimethyl)silyl]-6-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H](O)CO)OC(=O)[C@@]2([Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H28O6Si/c1-13(2,3)22(6,7)15-11(20-14(4,5)21-15)10(9(17)8-16)19-12(15)18/h9-11,16-17H,8H2,1-7H3/t9-,10-,11+,15-/m1/s1 |
| InChIKey | LRDQXRRGEMQZRR-YYHMBLRTSA-N |
| XLogP | 1.20 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|