C30H45NO4 — CID 67942003
(5R,8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-3,17-dimethoxy-17-(methoxymethyl)-13-methyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-5-ol (PubChem CID 67942003) has the molecular formula C30H45NO4 and a molecular weight of 483.69 g/mol. Its IUPAC name is (5R,8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-3,17-dimethoxy-17-(methoxymethyl)-13-methyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-5-ol.
| Compound Name | (5R,8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-3,17-dimethoxy-17-(methoxymethyl)-13-methyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 67942003 |
| Molecular Formula | C30H45NO4 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | (5R,8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-3,17-dimethoxy-17-(methoxymethyl)-13-methyl-1,2,3,4,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-5-ol |
| SMILES | COC[C@]1(OC)CC[C@H]2[C@@H]3CC[C@@]4(O)CC(OC)CCC4=C3[C@@H](c3ccc(N(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C30H45NO4/c1-28-18-24(20-7-9-21(10-8-20)31(2)3)27-23(25(28)14-16-30(28,35-6)19-33-4)13-15-29(32)17-22(34-5)11-12-26(27)29/h7-10,22-25,32H,11-19H2,1-6H3/t22?,23-,24+,25-,28-,29+,30+/m0/s1 |
| InChIKey | QTDJEXVIUWGFIW-XPDWMFJNSA-N |
| XLogP | 5.32 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|