About 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene
3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene (PubChem CID 67942354) has the molecular formula C8H9ClS
and a molecular weight of 172.68 g/mol. Its IUPAC name is 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene |
| PubChem CID | 67942354 |
| Molecular Formula | C8H9ClS |
| Molecular Weight | 172.68 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene |
| SMILES | ClC[C@@H]1C[C@H]1c1ccsc1 |
| InChI | InChI=1S/C8H9ClS/c9-4-7-3-8(7)6-1-2-10-5-6/h1-2,5,7-8H,3-4H2/t7-,8-/m0/s1 |
| InChIKey | UQTOFZUKDDYETJ-YUMQZZPRSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene?
The IUPAC name of 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene (CID 67942354) is 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene.
What is the SMILES notation for 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene?
The canonical SMILES for 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene is ClC[C@@H]1C[C@H]1c1ccsc1.
What is the InChIKey of 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene?
The InChIKey is UQTOFZUKDDYETJ-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H9ClS/c9-4-7-3-8(7)6-1-2-10-5-6/h1-2,5,7-8H,3-4H2/t7-,8-/m0/s1.
What are the key properties of 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene?
3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene has a molecular weight of 172.68 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-(chloromethyl)cyclopropyl]thiophene is sourced from PubChem (CID 67942354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).