About pyrido[2,3-b][1,4]thiazepine
pyrido[2,3-b][1,4]thiazepine (PubChem CID 67942669) has the molecular formula C8H6N2S
and a molecular weight of 162.22 g/mol. Its IUPAC name is pyrido[2,3-b][1,4]thiazepine.
Molecular Properties
| Compound Name | pyrido[2,3-b][1,4]thiazepine |
| PubChem CID | 67942669 |
| Molecular Formula | C8H6N2S |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | pyrido[2,3-b][1,4]thiazepine |
| SMILES | C1=CSc2ncccc2N=C1 |
| InChI | InChI=1S/C8H6N2S/c1-3-7-8(10-4-1)11-6-2-5-9-7/h1-6H |
| InChIKey | DRRWPYNMKWQKIB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrido[2,3-b][1,4]thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,3-b][1,4]thiazepine?
The IUPAC name of pyrido[2,3-b][1,4]thiazepine (CID 67942669) is pyrido[2,3-b][1,4]thiazepine.
What is the SMILES notation for pyrido[2,3-b][1,4]thiazepine?
The canonical SMILES for pyrido[2,3-b][1,4]thiazepine is C1=CSc2ncccc2N=C1.
What is the InChIKey of pyrido[2,3-b][1,4]thiazepine?
The InChIKey is DRRWPYNMKWQKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S/c1-3-7-8(10-4-1)11-6-2-5-9-7/h1-6H.
What are the key properties of pyrido[2,3-b][1,4]thiazepine?
pyrido[2,3-b][1,4]thiazepine has a molecular weight of 162.22 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-b][1,4]thiazepine is sourced from PubChem (CID 67942669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).