C6H7ClO2 — CID 67943553
4-chlorocyclohexa-1,5-diene-1,4-diol (PubChem CID 67943553) has the molecular formula C6H7ClO2 and a molecular weight of 146.57 g/mol. Its IUPAC name is 4-chlorocyclohexa-1,5-diene-1,4-diol.
| Compound Name | 4-chlorocyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 67943553 |
| Molecular Formula | C6H7ClO2 |
| Molecular Weight | 146.57 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | 4-chlorocyclohexa-1,5-diene-1,4-diol |
| SMILES | OC1=CCC(O)(Cl)C=C1 |
| InChI | InChI=1S/C6H7ClO2/c7-6(9)3-1-5(8)2-4-6/h1-3,8-9H,4H2 |
| InChIKey | IHLHXINGMCKLJO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.57 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|