C10H18N2O2 — CID 67943590
1,7-dimethyl-8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 67943590) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,7-dimethyl-8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 1,7-dimethyl-8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 67943590 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,7-dimethyl-8-(nitromethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC1CCN2CCC(C)C12C[N+](=O)[O-] |
| InChI | InChI=1S/C10H18N2O2/c1-8-3-5-11-6-4-9(2)10(8,11)7-12(13)14/h8-9H,3-7H2,1-2H3 |
| InChIKey | YGFHJGYAPPKPHY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|