C30H20F4N2O4 — CID 67943967
4-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 1-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluoro-3-phenylbenzene-1,4-dicarboxylate (PubChem CID 67943967) has the molecular formula C30H20F4N2O4 and a molecular weight of 548.49 g/mol. Its IUPAC name is 4-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 1-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluoro-3-phenylbenzene-1,4-dicarboxylate.
| Compound Name | 4-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 1-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluoro-3-phenylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67943967 |
| Molecular Formula | C30H20F4N2O4 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 4-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 1-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluoro-3-phenylbenzene-1,4-dicarboxylate |
| SMILES | C=CCc1cnc(-c2ccc(OC(=O)c3ccc(C(=O)OC(=C)C(F)(F)F)c(F)c3-c3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C30H20F4N2O4/c1-3-7-19-16-35-27(36-17-19)21-10-12-22(13-11-21)40-28(37)23-14-15-24(29(38)39-18(2)30(32,33)34)26(31)25(23)20-8-5-4-6-9-20/h3-6,8-17H,1-2,7H2 |
| InChIKey | GLKNHKHDKOTTPX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|