C26H24F2N2O3 — CID 67944493
6-[3-[4,5-bis(4-fluorophenyl)-2-prop-1-en-2-ylimidazol-1-yl]prop-1-enyl]-4-hydroxyoxan-2-one (PubChem CID 67944493) has the molecular formula C26H24F2N2O3 and a molecular weight of 450.49 g/mol. Its IUPAC name is 6-[3-[4,5-bis(4-fluorophenyl)-2-prop-1-en-2-ylimidazol-1-yl]prop-1-enyl]-4-hydroxyoxan-2-one.
| Compound Name | 6-[3-[4,5-bis(4-fluorophenyl)-2-prop-1-en-2-ylimidazol-1-yl]prop-1-enyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 67944493 |
| Molecular Formula | C26H24F2N2O3 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 6-[3-[4,5-bis(4-fluorophenyl)-2-prop-1-en-2-ylimidazol-1-yl]prop-1-enyl]-4-hydroxyoxan-2-one |
| SMILES | C=C(C)c1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC=CC1CC(O)CC(=O)O1 |
| InChI | InChI=1S/C26H24F2N2O3/c1-16(2)26-29-24(17-5-9-19(27)10-6-17)25(18-7-11-20(28)12-8-18)30(26)13-3-4-22-14-21(31)15-23(32)33-22/h3-12,21-22,31H,1,13-15H2,2H3 |
| InChIKey | ZZJUGPXQRXLWLN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|