About 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid
7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid (PubChem CID 67944496) has the molecular formula C7H8N4O3
and a molecular weight of 196.17 g/mol. Its IUPAC name is 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid.
Molecular Properties
| Compound Name | 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid |
| PubChem CID | 67944496 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N1c2ccccc21 |
| InChI | InChI=1S/C7H7N3.HNO3/c8-7(9)10-5-3-1-2-4-6(5)10;2-1(3)4/h1-4H,(H3,8,9);(H,2,3,4) |
| InChIKey | JKPMJHGSDCNQRV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid?
The IUPAC name of 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid (CID 67944496) is 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid.
What is the SMILES notation for 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid?
The canonical SMILES for 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid is O=[N+]([O-])O.[H]/N=C(\N)N1c2ccccc21.
What is the InChIKey of 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid?
The InChIKey is JKPMJHGSDCNQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.HNO3/c8-7(9)10-5-3-1-2-4-6(5)10;2-1(3)4/h1-4H,(H3,8,9);(H,2,3,4).
What are the key properties of 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid?
7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid has a molecular weight of 196.17 g/mol, XLogP of 0.68, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azabicyclo[4.1.0]hepta-1,3,5-triene-7-carboximidamide;nitric acid is sourced from PubChem (CID 67944496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).