C42H48F4O5 — CID 67944856
1,1,1-trifluorooctan-2-yl 4-[4-(4-decoxyphenyl)-3-fluorobenzoyl]oxynaphthalene-1-carboxylate (PubChem CID 67944856) has the molecular formula C42H48F4O5 and a molecular weight of 708.83 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 4-[4-(4-decoxyphenyl)-3-fluorobenzoyl]oxynaphthalene-1-carboxylate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 4-[4-(4-decoxyphenyl)-3-fluorobenzoyl]oxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 67944856 |
| Molecular Formula | C42H48F4O5 |
| Molecular Weight | 708.83 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 4-[4-(4-decoxyphenyl)-3-fluorobenzoyl]oxynaphthalene-1-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(CCCCCC)C(F)(F)F)c4ccccc34)cc2F)cc1 |
| InChI | InChI=1S/C42H48F4O5/c1-3-5-7-9-10-11-12-16-28-49-32-23-20-30(21-24-32)33-25-22-31(29-37(33)43)40(47)50-38-27-26-36(34-17-14-15-18-35(34)38)41(48)51-39(42(44,45)46)19-13-8-6-4-2/h14-15,17-18,20-27,29,39H,3-13,16,19,28H2,1-2H3 |
| InChIKey | KJLWKCHYQUSHLK-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.83 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|