About 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene
6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene (PubChem CID 67944945) has the molecular formula C21H23F
and a molecular weight of 294.41 g/mol. Its IUPAC name is 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| PubChem CID | 67944945 |
| Molecular Formula | C21H23F |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| SMILES | CC(=Cc1ccc(F)cc1)c1ccc2c(c1)C(C)(C)CCC2 |
| InChI | InChI=1S/C21H23F/c1-15(13-16-6-10-19(22)11-7-16)18-9-8-17-5-4-12-21(2,3)20(17)14-18/h6-11,13-14H,4-5,12H2,1-3H3 |
| InChIKey | LBABMDLWPSDEDY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The IUPAC name of 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene (CID 67944945) is 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene is CC(=Cc1ccc(F)cc1)c1ccc2c(c1)C(C)(C)CCC2.
What is the InChIKey of 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The InChIKey is LBABMDLWPSDEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F/c1-15(13-16-6-10-19(22)11-7-16)18-9-8-17-5-4-12-21(2,3)20(17)14-18/h6-11,13-14H,4-5,12H2,1-3H3.
What are the key properties of 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene has a molecular weight of 294.41 g/mol, XLogP of 6.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(4-fluorophenyl)prop-1-en-2-yl]-4,4-dimethyl-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 67944945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).