About N,N-dimethylprop-2-enamide;pyrrolidin-2-one
N,N-dimethylprop-2-enamide;pyrrolidin-2-one (PubChem CID 67945014) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide;pyrrolidin-2-one.
Molecular Properties
| Compound Name | N,N-dimethylprop-2-enamide;pyrrolidin-2-one |
| PubChem CID | 67945014 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N,N-dimethylprop-2-enamide;pyrrolidin-2-one |
| SMILES | C=CC(=O)N(C)C.O=C1CCCN1 |
| InChI | InChI=1S/C5H9NO.C4H7NO/c1-4-5(7)6(2)3;6-4-2-1-3-5-4/h4H,1H2,2-3H3;1-3H2,(H,5,6) |
| InChIKey | NKFUYSQBMXCFTR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylprop-2-enamide;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylprop-2-enamide;pyrrolidin-2-one?
The IUPAC name of N,N-dimethylprop-2-enamide;pyrrolidin-2-one (CID 67945014) is N,N-dimethylprop-2-enamide;pyrrolidin-2-one.
What is the SMILES notation for N,N-dimethylprop-2-enamide;pyrrolidin-2-one?
The canonical SMILES for N,N-dimethylprop-2-enamide;pyrrolidin-2-one is C=CC(=O)N(C)C.O=C1CCCN1.
What is the InChIKey of N,N-dimethylprop-2-enamide;pyrrolidin-2-one?
The InChIKey is NKFUYSQBMXCFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C4H7NO/c1-4-5(7)6(2)3;6-4-2-1-3-5-4/h4H,1H2,2-3H3;1-3H2,(H,5,6).
What are the key properties of N,N-dimethylprop-2-enamide;pyrrolidin-2-one?
N,N-dimethylprop-2-enamide;pyrrolidin-2-one has a molecular weight of 184.24 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylprop-2-enamide;pyrrolidin-2-one is sourced from PubChem (CID 67945014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).