About 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane
4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane (PubChem CID 67945027) has the molecular formula C30H32O4S
and a molecular weight of 488.65 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane.
Molecular Properties
| Compound Name | 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane |
| PubChem CID | 67945027 |
| Molecular Formula | C30H32O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane |
| SMILES | Oc1ccc(-c2ccc(O)cc2)cc1.Oc1ccc(C2(c3ccc(O)cc3)CCCCC2)cc1.S |
| InChI | InChI=1S/C18H20O2.C12H10O2.H2S/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h4-11,19-20H,1-3,12-13H2;1-8,13-14H;1H2 |
| InChIKey | UKPVDGPYLKPJSE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane?
The IUPAC name of 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane (CID 67945027) is 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane.
What is the SMILES notation for 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane?
The canonical SMILES for 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane is Oc1ccc(-c2ccc(O)cc2)cc1.Oc1ccc(C2(c3ccc(O)cc3)CCCCC2)cc1.S.
What is the InChIKey of 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane?
The InChIKey is UKPVDGPYLKPJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2.C12H10O2.H2S/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h4-11,19-20H,1-3,12-13H2;1-8,13-14H;1H2.
What are the key properties of 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane?
4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane has a molecular weight of 488.65 g/mol, XLogP of 7.23, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-(4-hydroxyphenyl)phenol;sulfane is sourced from PubChem (CID 67945027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).