C16H24N2O5 — CID 67945076
2-(carboxymethylamino)acetic acid;2-ethyl-N-phenylbutanamide (PubChem CID 67945076) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(carboxymethylamino)acetic acid;2-ethyl-N-phenylbutanamide.
| Compound Name | 2-(carboxymethylamino)acetic acid;2-ethyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 67945076 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-(carboxymethylamino)acetic acid;2-ethyl-N-phenylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccccc1.O=C(O)CNCC(=O)O |
| InChI | InChI=1S/C12H17NO.C4H7NO4/c1-3-10(4-2)12(14)13-11-8-6-5-7-9-11;6-3(7)1-5-2-4(8)9/h5-10H,3-4H2,1-2H3,(H,13,14);5H,1-2H2,(H,6,7)(H,8,9) |
| InChIKey | MKPDMKVISLNXMH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |