C12H20O2 — CID 67945243
1,4-di(propan-2-yl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 67945243) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | 1,4-di(propan-2-yl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 67945243 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1,4-di(propan-2-yl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | CC(C)C1=CC(O)C(O)(C(C)C)C=C1 |
| InChI | InChI=1S/C12H20O2/c1-8(2)10-5-6-12(14,9(3)4)11(13)7-10/h5-9,11,13-14H,1-4H3 |
| InChIKey | YFWFHOQVDLDDRL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |