About 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile
4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 67945346) has the molecular formula C17H17F3N2O2
and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile |
| PubChem CID | 67945346 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | CCCCC(Oc1ccc(C#N)cc1C(F)(F)F)c1cc(C)no1 |
| InChI | InChI=1S/C17H17F3N2O2/c1-3-4-5-15(16-8-11(2)22-24-16)23-14-7-6-12(10-21)9-13(14)17(18,19)20/h6-9,15H,3-5H2,1-2H3 |
| InChIKey | MHFFOSQJSLSITM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
The IUPAC name of 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile (CID 67945346) is 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
The canonical SMILES for 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile is CCCCC(Oc1ccc(C#N)cc1C(F)(F)F)c1cc(C)no1.
What is the InChIKey of 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
The InChIKey is MHFFOSQJSLSITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N2O2/c1-3-4-5-15(16-8-11(2)22-24-16)23-14-7-6-12(10-21)9-13(14)17(18,19)20/h6-9,15H,3-5H2,1-2H3.
What are the key properties of 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile?
4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile has a molecular weight of 338.33 g/mol, XLogP of 5.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3-methyl-1,2-oxazol-5-yl)pentoxy]-3-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 67945346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).