About 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide
2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide (PubChem CID 67945426) has the molecular formula C20H42IN3
and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide |
| PubChem CID | 67945426 |
| Molecular Formula | C20H42IN3 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide |
| SMILES | CC(C)CCCC(C)CCCC(C)N/C(N)=N/C1CCCCC1.I |
| InChI | InChI=1S/C20H41N3.HI/c1-16(2)10-8-11-17(3)12-9-13-18(4)22-20(21)23-19-14-6-5-7-15-19;/h16-19H,5-15H2,1-4H3,(H3,21,22,23);1H |
| InChIKey | VRIQACGKPWTQJA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide?
The IUPAC name of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide (CID 67945426) is 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide.
What is the SMILES notation for 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide?
The canonical SMILES for 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide is CC(C)CCCC(C)CCCC(C)N/C(N)=N/C1CCCCC1.I.
What is the InChIKey of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide?
The InChIKey is VRIQACGKPWTQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41N3.HI/c1-16(2)10-8-11-17(3)12-9-13-18(4)22-20(21)23-19-14-6-5-7-15-19;/h16-19H,5-15H2,1-4H3,(H3,21,22,23);1H.
What are the key properties of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide?
2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide has a molecular weight of 451.48 g/mol, XLogP of 5.86, 10 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine;hydroiodide is sourced from PubChem (CID 67945426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).