C11H12N4O2S2 — CID 67946084
N,N-dimethyl-N'-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]methanimidamide (PubChem CID 67946084) has the molecular formula C11H12N4O2S2 and a molecular weight of 296.38 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]methanimidamide |
|---|---|
| PubChem CID | 67946084 |
| Molecular Formula | C11H12N4O2S2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | N,N-dimethyl-N'-[(3-phenyl-1,2,4-thiadiazol-5-yl)sulfonyl]methanimidamide |
| SMILES | CN(C)C=NS(=O)(=O)c1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C11H12N4O2S2/c1-15(2)8-12-19(16,17)11-13-10(14-18-11)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | JDRFCBGBZJKQMT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|