C21H24N2O3 — CID 67946480
1,2,4,9b-tetrahydrochromeno[4,3-c]pyrazol-8-yl adamantane-1-carboxylate (PubChem CID 67946480) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1,2,4,9b-tetrahydrochromeno[4,3-c]pyrazol-8-yl adamantane-1-carboxylate.
| Compound Name | 1,2,4,9b-tetrahydrochromeno[4,3-c]pyrazol-8-yl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 67946480 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1,2,4,9b-tetrahydrochromeno[4,3-c]pyrazol-8-yl adamantane-1-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)C1NNC=C1CO2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24N2O3/c24-20(21-7-12-3-13(8-21)5-14(4-12)9-21)26-16-1-2-18-17(6-16)19-15(11-25-18)10-22-23-19/h1-2,6,10,12-14,19,22-23H,3-5,7-9,11H2 |
| InChIKey | WUIFLBWPNUUMPO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|