C21H14ClN3O4 — CID 67946536
2-cyanoethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate (PubChem CID 67946536) has the molecular formula C21H14ClN3O4 and a molecular weight of 407.81 g/mol. Its IUPAC name is 2-cyanoethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate.
| Compound Name | 2-cyanoethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate |
|---|---|
| PubChem CID | 67946536 |
| Molecular Formula | C21H14ClN3O4 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-cyanoethyl 2-[2-(4-chlorophenyl)-3-oxochromeno[4,3-c]pyrazol-4-yl]acetate |
| SMILES | N#CCCOC(=O)Cc1oc2ccccc2c2nn(-c3ccc(Cl)cc3)c(=O)c1-2 |
| InChI | InChI=1S/C21H14ClN3O4/c22-13-6-8-14(9-7-13)25-21(27)19-17(12-18(26)28-11-3-10-23)29-16-5-2-1-4-15(16)20(19)24-25/h1-2,4-9H,3,11-12H2 |
| InChIKey | CRGXKEAKRIBPBJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|