About 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole
2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole (PubChem CID 67946669) has the molecular formula C27H24N4S3
and a molecular weight of 500.72 g/mol. Its IUPAC name is 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole.
Molecular Properties
| Compound Name | 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole |
| PubChem CID | 67946669 |
| Molecular Formula | C27H24N4S3 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole |
| SMILES | c1ccc(-c2nc(Cc3ccsc3)c(Cc3ccsc3)[nH]2)cc1.c1cn(Cc2ccsc2)cn1 |
| InChI | InChI=1S/C19H16N2S2.C8H8N2S/c1-2-4-16(5-3-1)19-20-17(10-14-6-8-22-12-14)18(21-19)11-15-7-9-23-13-15;1-4-11-6-8(1)5-10-3-2-9-7-10/h1-9,12-13H,10-11H2,(H,20,21);1-4,6-7H,5H2 |
| InChIKey | MJZZMLKKWKFJHY-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole?
The IUPAC name of 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole (CID 67946669) is 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole.
What is the SMILES notation for 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole?
The canonical SMILES for 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole is c1ccc(-c2nc(Cc3ccsc3)c(Cc3ccsc3)[nH]2)cc1.c1cn(Cc2ccsc2)cn1.
What is the InChIKey of 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole?
The InChIKey is MJZZMLKKWKFJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2S2.C8H8N2S/c1-2-4-16(5-3-1)19-20-17(10-14-6-8-22-12-14)18(21-19)11-15-7-9-23-13-15;1-4-11-6-8(1)5-10-3-2-9-7-10/h1-9,12-13H,10-11H2,(H,20,21);1-4,6-7H,5H2.
What are the key properties of 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole?
2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole has a molecular weight of 500.72 g/mol, XLogP of 7.37, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4,5-bis(thiophen-3-ylmethyl)-1H-imidazole;1-(thiophen-3-ylmethyl)imidazole is sourced from PubChem (CID 67946669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).