C24H32O6 — CID 67946879
(2Z,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid (PubChem CID 67946879) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (2Z,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid.
| Compound Name | (2Z,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid |
|---|---|
| PubChem CID | 67946879 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2Z,6E,10E)-12-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10-trimethyldodeca-2,6,10-trienoic acid |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CC/C=C(\C)CC/C=C(/C)C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C24H32O6/c1-15(11-8-12-17(3)24(27)28)9-7-10-16(2)13-14-19-18(4)20(25)22(29-5)23(30-6)21(19)26/h9,12-13H,7-8,10-11,14H2,1-6H3,(H,27,28)/b15-9+,16-13+,17-12- |
| InChIKey | GUBYYJQSWUYTDA-IRVGPDADSA-N |
| XLogP | 4.83 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|