C10H12BrNO3 — CID 67947751
(3S,4R)-3-bromo-2,2-dimethyl-6-oxido-3,4-dihydropyrano[3,2-c]pyridin-6-ium-4-ol (PubChem CID 67947751) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is (3S,4R)-3-bromo-2,2-dimethyl-6-oxido-3,4-dihydropyrano[3,2-c]pyridin-6-ium-4-ol.
| Compound Name | (3S,4R)-3-bromo-2,2-dimethyl-6-oxido-3,4-dihydropyrano[3,2-c]pyridin-6-ium-4-ol |
|---|---|
| PubChem CID | 67947751 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (3S,4R)-3-bromo-2,2-dimethyl-6-oxido-3,4-dihydropyrano[3,2-c]pyridin-6-ium-4-ol |
| SMILES | CC1(C)Oc2cc[n+]([O-])cc2[C@@H](O)[C@@H]1Br |
| InChI | InChI=1S/C10H12BrNO3/c1-10(2)9(11)8(13)6-5-12(14)4-3-7(6)15-10/h3-5,8-9,13H,1-2H3/t8-,9+/m1/s1 |
| InChIKey | MXPNQHOAYPIDIQ-BDAKNGLRSA-N |
| XLogP | 1.29 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|