About 4-ethoxy-3-nitrobenzoic acid
4-ethoxy-3-nitrobenzoic acid (PubChem CID 679478) has the molecular formula C9H9NO5
and a molecular weight of 211.17 g/mol. Its IUPAC name is 4-ethoxy-3-nitrobenzoic acid.
Molecular Properties
| Compound Name | 4-ethoxy-3-nitrobenzoic acid |
| PubChem CID | 679478 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 4-ethoxy-3-nitrobenzoic acid |
| SMILES | CCOc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO5/c1-2-15-8-4-3-6(9(11)12)5-7(8)10(13)14/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | GZHXYRWGRKIXEJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-3-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3-nitrobenzoic acid?
The IUPAC name of 4-ethoxy-3-nitrobenzoic acid (CID 679478) is 4-ethoxy-3-nitrobenzoic acid.
What is the SMILES notation for 4-ethoxy-3-nitrobenzoic acid?
The canonical SMILES for 4-ethoxy-3-nitrobenzoic acid is CCOc1ccc(C(=O)O)cc1[N+](=O)[O-].
What is the InChIKey of 4-ethoxy-3-nitrobenzoic acid?
The InChIKey is GZHXYRWGRKIXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO5/c1-2-15-8-4-3-6(9(11)12)5-7(8)10(13)14/h3-5H,2H2,1H3,(H,11,12).
What are the key properties of 4-ethoxy-3-nitrobenzoic acid?
4-ethoxy-3-nitrobenzoic acid has a molecular weight of 211.17 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3-nitrobenzoic acid is sourced from PubChem (CID 679478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).