C10H15NO2 — CID 67948044
1,2-diethyl-2H-pyridin-1-ium-1-carboxylate (PubChem CID 67948044) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1,2-diethyl-2H-pyridin-1-ium-1-carboxylate.
| Compound Name | 1,2-diethyl-2H-pyridin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 67948044 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1,2-diethyl-2H-pyridin-1-ium-1-carboxylate |
| SMILES | CCC1C=CC=C[N+]1(CC)C(=O)[O-] |
| InChI | InChI=1S/C10H15NO2/c1-3-9-7-5-6-8-11(9,4-2)10(12)13/h5-9H,3-4H2,1-2H3 |
| InChIKey | WKTNALALZKWNHY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|