About 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride
3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride (PubChem CID 67948190) has the molecular formula C9H14ClFeNO2
and a molecular weight of 259.51 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride.
Molecular Properties
| Compound Name | 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride |
| PubChem CID | 67948190 |
| Molecular Formula | C9H14ClFeNO2 |
| Molecular Weight | 259.51 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride |
| SMILES | CCCn1ccc(=O)c(O)c1C.Cl.[Fe] |
| InChI | InChI=1S/C9H13NO2.ClH.Fe/c1-3-5-10-6-4-8(11)9(12)7(10)2;;/h4,6,12H,3,5H2,1-2H3;1H; |
| InChIKey | PHWXTUDJQSBJRJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride?
The IUPAC name of 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride (CID 67948190) is 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride.
What is the SMILES notation for 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride?
The canonical SMILES for 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride is CCCn1ccc(=O)c(O)c1C.Cl.[Fe].
What is the InChIKey of 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride?
The InChIKey is PHWXTUDJQSBJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2.ClH.Fe/c1-3-5-10-6-4-8(11)9(12)7(10)2;;/h4,6,12H,3,5H2,1-2H3;1H;.
What are the key properties of 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride?
3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride has a molecular weight of 259.51 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-methyl-1-propylpyridin-4-one;iron;hydrochloride is sourced from PubChem (CID 67948190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).