C16H18N4O4S — CID 67948272
(4-nitrophenyl)methyl N-[N'-(3-thiophen-2-ylpropyl)carbamimidoyl]carbamate (PubChem CID 67948272) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[N'-(3-thiophen-2-ylpropyl)carbamimidoyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[N'-(3-thiophen-2-ylpropyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 67948272 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (4-nitrophenyl)methyl N-[N'-(3-thiophen-2-ylpropyl)carbamimidoyl]carbamate |
| SMILES | N/C(=N\CCCc1cccs1)NC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N4O4S/c17-15(18-9-1-3-14-4-2-10-25-14)19-16(21)24-11-12-5-7-13(8-6-12)20(22)23/h2,4-8,10H,1,3,9,11H2,(H3,17,18,19,21) |
| InChIKey | IBGNUFWCABVYRB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|