C19H19BrN4 — CID 67948626
6-(bromomethyl)-2-N,4-N-bis(2-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 67948626) has the molecular formula C19H19BrN4 and a molecular weight of 383.29 g/mol. Its IUPAC name is 6-(bromomethyl)-2-N,4-N-bis(2-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(bromomethyl)-2-N,4-N-bis(2-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67948626 |
| Molecular Formula | C19H19BrN4 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 6-(bromomethyl)-2-N,4-N-bis(2-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1cc(CBr)nc(Nc2ccccc2C)n1 |
| InChI | InChI=1S/C19H19BrN4/c1-13-7-3-5-9-16(13)22-18-11-15(12-20)21-19(24-18)23-17-10-6-4-8-14(17)2/h3-11H,12H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | KYPWZLZIRMSAFR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|