C28H28ClFN2O5 — CID 67949364
3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea (PubChem CID 67949364) has the molecular formula C28H28ClFN2O5 and a molecular weight of 526.99 g/mol. Its IUPAC name is 3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea.
| Compound Name | 3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 67949364 |
| Molecular Formula | C28H28ClFN2O5 |
| Molecular Weight | 526.99 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 3-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]-1,1-dimethylurea |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Cl)cc3)[C@H](c3cccc(F)c3)C[C@H](NC(=O)N(C)C)[C@@]21O |
| InChI | InChI=1S/C28H28ClFN2O5/c1-32(2)26(33)31-24-15-21(16-6-5-7-19(30)12-16)28(17-8-10-18(29)11-9-17)27(24,34)25-22(36-4)13-20(35-3)14-23(25)37-28/h5-14,21,24,34H,15H2,1-4H3,(H,31,33)/t21-,24-,27+,28-/m0/s1 |
| InChIKey | QCKWIAIFJDRBOV-TXSIRGRGSA-N |
| XLogP | 4.80 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.99 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |