C28H27BrFNO5 — CID 67949367
N-[(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]propanamide (PubChem CID 67949367) has the molecular formula C28H27BrFNO5 and a molecular weight of 556.43 g/mol. Its IUPAC name is N-[(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]propanamide.
| Compound Name | N-[(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]propanamide |
|---|---|
| PubChem CID | 67949367 |
| Molecular Formula | C28H27BrFNO5 |
| Molecular Weight | 556.43 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | N-[(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1C[C@@H](c2cccc(F)c2)[C@]2(c3ccc(Br)cc3)Oc3cc(OC)cc(OC)c3[C@]12O |
| InChI | InChI=1S/C28H27BrFNO5/c1-4-25(32)31-24-15-21(16-6-5-7-19(30)12-16)28(17-8-10-18(29)11-9-17)27(24,33)26-22(35-3)13-20(34-2)14-23(26)36-28/h5-14,21,24,33H,4,15H2,1-3H3,(H,31,32)/t21-,24-,27+,28-/m0/s1 |
| InChIKey | ZQOVNXHHRHEKCT-TXSIRGRGSA-N |
| XLogP | 5.16 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |