About 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol
3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol (PubChem CID 67949815) has the molecular formula C18H20N6O2
and a molecular weight of 352.40 g/mol. Its IUPAC name is 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol.
Molecular Properties
| Compound Name | 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol |
| PubChem CID | 67949815 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol |
| SMILES | OC1(C2CN(c3cccc(-c4[nH]nc5ncccc45)n3)CCN2)COC1 |
| InChI | InChI=1S/C18H20N6O2/c25-18(10-26-11-18)14-9-24(8-7-19-14)15-5-1-4-13(21-15)16-12-3-2-6-20-17(12)23-22-16/h1-6,14,19,25H,7-11H2,(H,20,22,23) |
| InChIKey | OVGZUGGCTRMRTC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol?
The IUPAC name of 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol (CID 67949815) is 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol.
What is the SMILES notation for 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol?
The canonical SMILES for 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol is OC1(C2CN(c3cccc(-c4[nH]nc5ncccc45)n3)CCN2)COC1.
What is the InChIKey of 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol?
The InChIKey is OVGZUGGCTRMRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6O2/c25-18(10-26-11-18)14-9-24(8-7-19-14)15-5-1-4-13(21-15)16-12-3-2-6-20-17(12)23-22-16/h1-6,14,19,25H,7-11H2,(H,20,22,23).
What are the key properties of 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol?
3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol has a molecular weight of 352.40 g/mol, XLogP of 0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[6-(2H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol is sourced from PubChem (CID 67949815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).