C20H18ClF2N3O2 — CID 67950034
7-(5-chloro-3-pyridinyl)-2,2-difluorospiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67950034) has the molecular formula C20H18ClF2N3O2 and a molecular weight of 405.83 g/mol. Its IUPAC name is 7-(5-chloro-3-pyridinyl)-2,2-difluorospiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | 7-(5-chloro-3-pyridinyl)-2,2-difluorospiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67950034 |
| Molecular Formula | C20H18ClF2N3O2 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 7-(5-chloro-3-pyridinyl)-2,2-difluorospiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | NC1=NC2(CO1)c1cc(-c3cncc(Cl)c3)ccc1OC1CCC(F)(F)CC12 |
| InChI | InChI=1S/C20H18ClF2N3O2/c21-13-5-12(8-25-9-13)11-1-2-16-14(6-11)20(10-27-18(24)26-20)15-7-19(22,23)4-3-17(15)28-16/h1-2,5-6,8-9,15,17H,3-4,7,10H2,(H2,24,26) |
| InChIKey | LITRRVNESGFZSL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |