C24H26N4O3 — CID 67950064
5-[(8aR,9R)-2'-amino-7-propan-2-yloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]pyridine-3-carbonitrile (PubChem CID 67950064) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-[(8aR,9R)-2'-amino-7-propan-2-yloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[(8aR,9R)-2'-amino-7-propan-2-yloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67950064 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 5-[(8aR,9R)-2'-amino-7-propan-2-yloxyspiro[5,6,7,8,8a,10a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-yl]pyridine-3-carbonitrile |
| SMILES | CC(C)OC1CCC2Oc3ccc(-c4cncc(C#N)c4)cc3[C@@]3(COC(N)=N3)[C@H]2C1 |
| InChI | InChI=1S/C24H26N4O3/c1-14(2)30-18-4-6-22-20(9-18)24(13-29-23(26)28-24)19-8-16(3-5-21(19)31-22)17-7-15(10-25)11-27-12-17/h3,5,7-8,11-12,14,18,20,22H,4,6,9,13H2,1-2H3,(H2,26,28)/t18?,20-,22?,24-/m0/s1 |
| InChIKey | FLLKCBZYBKWVGS-WCKNFHOJSA-N |
| XLogP | 3.52 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |