C21H20F3N3O3 — CID 67950081
(2S,9aR)-2'-amino-7-[5-(trifluoromethyl)-3-pyridinyl]spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol (PubChem CID 67950081) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is (2S,9aR)-2'-amino-7-[5-(trifluoromethyl)-3-pyridinyl]spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol.
| Compound Name | (2S,9aR)-2'-amino-7-[5-(trifluoromethyl)-3-pyridinyl]spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol |
|---|---|
| PubChem CID | 67950081 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (2S,9aR)-2'-amino-7-[5-(trifluoromethyl)-3-pyridinyl]spiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-oxazole]-2-ol |
| SMILES | NC1=NC2(CO1)c1cc(-c3cncc(C(F)(F)F)c3)ccc1OC1CC[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C21H20F3N3O3/c22-21(23,24)13-5-12(8-26-9-13)11-1-3-17-15(6-11)20(10-29-19(25)27-20)16-7-14(28)2-4-18(16)30-17/h1,3,5-6,8-9,14,16,18,28H,2,4,7,10H2,(H2,25,27)/t14-,16-,18?,20?/m0/s1 |
| InChIKey | MSRRSAWUTANYOM-AWZWZGLCSA-N |
| XLogP | 3.23 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |