C20H18ClFN2O3 — CID 67950143
(4aS,5R,10aS)-7-(3-chloro-5-fluorophenyl)spiro[3,4,4a,10a-tetrahydro-1H-pyrano[3,4-b]chromene-5,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67950143) has the molecular formula C20H18ClFN2O3 and a molecular weight of 388.83 g/mol. Its IUPAC name is (4aS,5R,10aS)-7-(3-chloro-5-fluorophenyl)spiro[3,4,4a,10a-tetrahydro-1H-pyrano[3,4-b]chromene-5,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (4aS,5R,10aS)-7-(3-chloro-5-fluorophenyl)spiro[3,4,4a,10a-tetrahydro-1H-pyrano[3,4-b]chromene-5,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67950143 |
| Molecular Formula | C20H18ClFN2O3 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (4aS,5R,10aS)-7-(3-chloro-5-fluorophenyl)spiro[3,4,4a,10a-tetrahydro-1H-pyrano[3,4-b]chromene-5,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | NC1=N[C@@]2(CO1)c1cc(-c3cc(F)cc(Cl)c3)ccc1O[C@@H]1COCC[C@H]12 |
| InChI | InChI=1S/C20H18ClFN2O3/c21-13-5-12(6-14(22)8-13)11-1-2-17-16(7-11)20(10-26-19(23)24-20)15-3-4-25-9-18(15)27-17/h1-2,5-8,15,18H,3-4,9-10H2,(H2,23,24)/t15-,18-,20-/m1/s1 |
| InChIKey | DUKBXFIKVQSRBG-XFQXTVEOSA-N |
| XLogP | 3.48 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |