C20H20ClN3O3 — CID 67950202
(4aS,10R,10aS)-8-(5-chloro-3-pyridinyl)-4a-methylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67950202) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is (4aS,10R,10aS)-8-(5-chloro-3-pyridinyl)-4a-methylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (4aS,10R,10aS)-8-(5-chloro-3-pyridinyl)-4a-methylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67950202 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (4aS,10R,10aS)-8-(5-chloro-3-pyridinyl)-4a-methylspiro[1,3,4,10a-tetrahydropyrano[4,3-b]chromene-10,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | C[C@]12CCOC[C@@H]1[C@]1(COC(N)=N1)c1cc(-c3cncc(Cl)c3)ccc1O2 |
| InChI | InChI=1S/C20H20ClN3O3/c1-19-4-5-25-10-17(19)20(11-26-18(22)24-20)15-7-12(2-3-16(15)27-19)13-6-14(21)9-23-8-13/h2-3,6-9,17H,4-5,10-11H2,1H3,(H2,22,24)/t17-,19-,20-/m0/s1 |
| InChIKey | RDZAVTLTLVWTMX-IHPCNDPISA-N |
| XLogP | 3.13 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |