About 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine
4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine (PubChem CID 67950924) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine |
| PubChem CID | 67950924 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine |
| SMILES | CC1CC(OCC2=CC=CCC2)CN1C |
| InChI | InChI=1S/C13H21NO/c1-11-8-13(9-14(11)2)15-10-12-6-4-3-5-7-12/h3-4,6,11,13H,5,7-10H2,1-2H3 |
| InChIKey | IFTAZTWZWXRNGO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine?
The IUPAC name of 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine (CID 67950924) is 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine.
What is the SMILES notation for 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine?
The canonical SMILES for 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine is CC1CC(OCC2=CC=CCC2)CN1C.
What is the InChIKey of 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine?
The InChIKey is IFTAZTWZWXRNGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-11-8-13(9-14(11)2)15-10-12-6-4-3-5-7-12/h3-4,6,11,13H,5,7-10H2,1-2H3.
What are the key properties of 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine?
4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine has a molecular weight of 207.32 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexa-1,3-dien-1-ylmethoxy)-1,2-dimethylpyrrolidine is sourced from PubChem (CID 67950924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).