About 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine
5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine (PubChem CID 67951124) has the molecular formula C8H7F3N2
and a molecular weight of 188.15 g/mol. Its IUPAC name is 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine.
Molecular Properties
| Compound Name | 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine |
| PubChem CID | 67951124 |
| Molecular Formula | C8H7F3N2 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine |
| SMILES | FC(F)(F)[C@H]1C[C@@H]1c1cncnc1 |
| InChI | InChI=1S/C8H7F3N2/c9-8(10,11)7-1-6(7)5-2-12-4-13-3-5/h2-4,6-7H,1H2/t6-,7+/m1/s1 |
| InChIKey | MFKFEIXFMGENLL-RQJHMYQMSA-N |
| XLogP | 2.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine?
The IUPAC name of 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine (CID 67951124) is 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine.
What is the SMILES notation for 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine?
The canonical SMILES for 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine is FC(F)(F)[C@H]1C[C@@H]1c1cncnc1.
What is the InChIKey of 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine?
The InChIKey is MFKFEIXFMGENLL-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H7F3N2/c9-8(10,11)7-1-6(7)5-2-12-4-13-3-5/h2-4,6-7H,1H2/t6-,7+/m1/s1.
What are the key properties of 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine?
5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine has a molecular weight of 188.15 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyrimidine is sourced from PubChem (CID 67951124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).